![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
---|
|
![[DIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | b.sc(hons) botany plant development and anatomy btht 405 sem iv 751.pdf | 20-Aug-2015 12:03 | 198K | |
![[ ]](/icons/layout.gif) | b.sc(hons)botany plant ecology and phytogeography(btht 406) sem iv 752.pdf | 20-Aug-2015 12:04 | 169K | |
![[ ]](/icons/layout.gif) | b.sc(hons) botany zoology biochemistry bio medical microbiology anthropology molecular biology ii(mbht 402) sem iv 754.pdf | 20-Aug-2015 12:03 | 150K | |
![[ ]](/icons/layout.gif) | b.sc (hons.) biotany plant systematics sem-iv-2328.pdf | 20-Aug-2015 12:14 | 187K | |
![[ ]](/icons/layout.gif) | b.sc.(hons)botany concepts of genetics sem-iv-2379.pdf | 20-Aug-2015 12:14 | 216K | |
|