![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| b.sc(hons) microbiology microbial ecology[miht 407] sem iv 1136.pdf | 20-Aug-2015 12:04 | 121K | |
| b.sc(hons) microbiology microbiol physiology and metabolism ii[miht 406] sem iv 1135.pdf | 24-Aug-2015 16:46 | 456K | |
| b.sc (hons.) microbiology (three year course of undergraduate erstwhile fyup ) microbial genetics and genomics sem-iv-2337.pdf | 20-Aug-2015 12:14 | 129K | |
| b.sc.(h) microbiology cell biology sem-iv-2368.pdf | 20-Aug-2015 12:14 | 137K | |
| b.sc.(hons)microbiology molecular biology sem-iv-2387.pdf | 20-Aug-2015 12:14 | 130K | |